C40H49N7O12 — CID 68991207
ethyl 3-[[2-[[4-[(hexoxycarbonylhydrazinylidene)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 68991207) has the molecular formula C40H49N7O12 and a molecular weight of 819.87 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-[(hexoxycarbonylhydrazinylidene)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | ethyl 3-[[2-[[4-[(hexoxycarbonylhydrazinylidene)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 68991207 |
| Molecular Formula | C40H49N7O12 |
| Molecular Weight | 819.87 g/mol |
| Exact Mass | 819.34 |
| IUPAC Name | ethyl 3-[[2-[[4-[(hexoxycarbonylhydrazinylidene)methyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCOC(=O)NN=Cc1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H41N7O5.C6H8O7/c1-4-6-7-10-21-46-34(44)39-37-23-25-12-15-27(16-13-25)36-24-31-38-28-22-26(14-17-29(28)40(31)3)33(43)41(20-18-32(42)45-5-2)30-11-8-9-19-35-30;7-3(8)1-6(13,5(11)12)2-4(9)10/h8-9,11-17,19,22-23,36H,4-7,10,18,20-21,24H2,1-3H3,(H,39,44);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | PGXOMEUTUOCKKW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 272.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|