C34H42N6O6 — CID 73213623
ethyl 3-[[2-[1-[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 73213623) has the molecular formula C34H42N6O6 and a molecular weight of 630.75 g/mol. Its IUPAC name is ethyl 3-[[2-[1-[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[1-[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 73213623 |
| Molecular Formula | C34H42N6O6 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | ethyl 3-[[2-[1-[4-[amino-(pentoxycarbonylamino)methyl]phenoxy]ethyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCOC(=O)NC(N)c1ccc(OC(C)c2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C34H42N6O6/c1-5-7-10-21-45-34(43)38-31(35)24-12-15-26(16-13-24)46-23(3)32-37-27-22-25(14-17-28(27)39(32)4)33(42)40(20-18-30(41)44-6-2)29-11-8-9-19-36-29/h8-9,11-17,19,22-23,31H,5-7,10,18,20-21,35H2,1-4H3,(H,38,43) |
| InChIKey | JALZYWIVAPUCPE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|