C20H22N4O4 — CID 118909548
ethyl 3-[(2-methoxy-1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate (PubChem CID 118909548) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl 3-[(2-methoxy-1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[(2-methoxy-1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 118909548 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl 3-[(2-methoxy-1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(OC)n2C)c1ccccn1 |
| InChI | InChI=1S/C20H22N4O4/c1-4-28-18(25)10-12-24(17-7-5-6-11-21-17)19(26)14-8-9-16-15(13-14)22-20(27-3)23(16)2/h5-9,11,13H,4,10,12H2,1-3H3 |
| InChIKey | VJTLKPRJSUDVIA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |