C27H30N6O3 — CID 142858785
ethyl 3-[[2-[[[(2E,4E)-5-cyanohexa-2,4-dien-2-yl]amino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 142858785) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is ethyl 3-[[2-[[[(2E,4E)-5-cyanohexa-2,4-dien-2-yl]amino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[2-[[[(2E,4E)-5-cyanohexa-2,4-dien-2-yl]amino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 142858785 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | ethyl 3-[[2-[[[(2E,4E)-5-cyanohexa-2,4-dien-2-yl]amino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CN/C(C)=C/C=C(\C)C#N)n2C)c1ccccn1 |
| InChI | InChI=1S/C27H30N6O3/c1-5-36-26(34)13-15-33(24-8-6-7-14-29-24)27(35)21-11-12-23-22(16-21)31-25(32(23)4)18-30-20(3)10-9-19(2)17-28/h6-12,14,16,30H,5,13,15,18H2,1-4H3/b19-9+,20-10+ |
| InChIKey | SJUNXCPSZLXZQW-LQGKIZFRSA-N |
| XLogP | 4.03 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|