C17H18N2O3 — CID 141002175
ethyl 3-[benzoyl(pyridin-2-yl)amino]propanoate (PubChem CID 141002175) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 3-[benzoyl(pyridin-2-yl)amino]propanoate.
| Compound Name | ethyl 3-[benzoyl(pyridin-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 141002175 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | ethyl 3-[benzoyl(pyridin-2-yl)amino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C17H18N2O3/c1-2-22-16(20)11-13-19(15-10-6-7-12-18-15)17(21)14-8-4-3-5-9-14/h3-10,12H,2,11,13H2,1H3 |
| InChIKey | BBECZFOIHRTYDG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |