C18H21N4O9P-2 — CID 71609199
ethyl 3-[[4-(methylamino)-3-nitrobenzoyl]-pyridin-2-ylamino]propanoate;hydrogen phosphate (PubChem CID 71609199) has the molecular formula C18H21N4O9P-2 and a molecular weight of 468.36 g/mol. Its IUPAC name is ethyl 3-[[4-(methylamino)-3-nitrobenzoyl]-pyridin-2-ylamino]propanoate;hydrogen phosphate.
| Compound Name | ethyl 3-[[4-(methylamino)-3-nitrobenzoyl]-pyridin-2-ylamino]propanoate;hydrogen phosphate |
|---|---|
| PubChem CID | 71609199 |
| Molecular Formula | C18H21N4O9P-2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | ethyl 3-[[4-(methylamino)-3-nitrobenzoyl]-pyridin-2-ylamino]propanoate;hydrogen phosphate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc(NC)c([N+](=O)[O-])c1)c1ccccn1.O=P([O-])([O-])O |
| InChI | InChI=1S/C18H20N4O5.H3O4P/c1-3-27-17(23)9-11-21(16-6-4-5-10-20-16)18(24)13-7-8-14(19-2)15(12-13)22(25)26;1-5(2,3)4/h4-8,10,12,19H,3,9,11H2,1-2H3;(H3,1,2,3,4)/p-2 |
| InChIKey | RKGNMEHNNIRTTJ-UHFFFAOYSA-L |
| XLogP | 0.44 |
| TPSA | 198.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|