About pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate
pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate (PubChem CID 46558384) has the molecular formula C14H13N3O4
and a molecular weight of 287.27 g/mol. Its IUPAC name is pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate |
| PubChem CID | 46558384 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCc2ccccn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N3O4/c1-15-12-6-5-10(8-13(12)17(19)20)14(18)21-9-11-4-2-3-7-16-11/h2-8,15H,9H2,1H3 |
| InChIKey | IQDBUIWACBLXEN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate?
The IUPAC name of pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate (CID 46558384) is pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate.
What is the SMILES notation for pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate?
The canonical SMILES for pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate is CNc1ccc(C(=O)OCc2ccccn2)cc1[N+](=O)[O-].
What is the InChIKey of pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate?
The InChIKey is IQDBUIWACBLXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O4/c1-15-12-6-5-10(8-13(12)17(19)20)14(18)21-9-11-4-2-3-7-16-11/h2-8,15H,9H2,1H3.
What are the key properties of pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate?
pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate has a molecular weight of 287.27 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 4-(methylamino)-3-nitrobenzoate is sourced from PubChem (CID 46558384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).