About pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate
pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate (PubChem CID 38123406) has the molecular formula C16H16N2O6
and a molecular weight of 332.31 g/mol. Its IUPAC name is pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate |
| PubChem CID | 38123406 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc(C(=O)OCc2ccccn2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H16N2O6/c1-3-23-15-8-12(13(18(20)21)9-14(15)22-2)16(19)24-10-11-6-4-5-7-17-11/h4-9H,3,10H2,1-2H3 |
| InChIKey | HJFMJULZFNWXBG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate?
The IUPAC name of pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate (CID 38123406) is pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate.
What is the SMILES notation for pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate?
The canonical SMILES for pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate is CCOc1cc(C(=O)OCc2ccccn2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate?
The InChIKey is HJFMJULZFNWXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O6/c1-3-23-15-8-12(13(18(20)21)9-14(15)22-2)16(19)24-10-11-6-4-5-7-17-11/h4-9H,3,10H2,1-2H3.
What are the key properties of pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate?
pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate has a molecular weight of 332.31 g/mol, XLogP of 2.75, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 5-ethoxy-4-methoxy-2-nitrobenzoate is sourced from PubChem (CID 38123406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).