C20H21NO9 — CID 9124883
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 9124883) has the molecular formula C20H21NO9 and a molecular weight of 419.39 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 9124883 |
| Molecular Formula | C20H21NO9 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCC(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H21NO9/c1-5-29-19-10-14(21(24)25)13(9-18(19)28-4)20(23)30-11-15(22)12-6-7-16(26-2)17(8-12)27-3/h6-10H,5,11H2,1-4H3 |
| InChIKey | GWTYKGGZTUYBGE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|