C17H14ClNO7 — CID 7471099
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 7471099) has the molecular formula C17H14ClNO7 and a molecular weight of 379.75 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7471099 |
| Molecular Formula | C17H14ClNO7 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C17H14ClNO7/c1-24-15-6-4-10(8-16(15)25-2)14(20)9-26-17(21)11-3-5-12(18)13(7-11)19(22)23/h3-8H,9H2,1-2H3 |
| InChIKey | ZUGDSNAJSYDSFR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|