C16H11Cl2NO6 — CID 60545444
methyl 4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]-3-nitrobenzoate (PubChem CID 60545444) has the molecular formula C16H11Cl2NO6 and a molecular weight of 384.17 g/mol. Its IUPAC name is methyl 4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 60545444 |
| Molecular Formula | C16H11Cl2NO6 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | methyl 4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)c2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11Cl2NO6/c1-24-16(21)10-3-5-15(13(7-10)19(22)23)25-8-14(20)9-2-4-11(17)12(18)6-9/h2-7H,8H2,1H3 |
| InChIKey | PWYPIYTVOLDVFG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|