C19H19N3O7 — CID 33064243
methyl 3-nitro-4-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethoxy]benzoate (PubChem CID 33064243) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is methyl 3-nitro-4-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethoxy]benzoate.
| Compound Name | methyl 3-nitro-4-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 33064243 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 3-nitro-4-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)c2c[nH]c(C(=O)N3CCCC3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O7/c1-28-19(25)12-4-5-17(15(9-12)22(26)27)29-11-16(23)13-8-14(20-10-13)18(24)21-6-2-3-7-21/h4-5,8-10,20H,2-3,6-7,11H2,1H3 |
| InChIKey | UIRBEDWOJFGRMA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|