C16H13ClN2O7 — CID 2575796
(2-amino-2-oxoethyl) 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate (PubChem CID 2575796) has the molecular formula C16H13ClN2O7 and a molecular weight of 380.74 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate.
| Compound Name | (2-amino-2-oxoethyl) 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 2575796 |
| Molecular Formula | C16H13ClN2O7 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(N)=O)ccc1Oc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13ClN2O7/c1-24-14-6-9(16(21)25-8-15(18)20)2-4-13(14)26-12-5-3-10(17)7-11(12)19(22)23/h2-7H,8H2,1H3,(H2,18,20) |
| InChIKey | VJGBIDNJFRTRSV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|