C17H14ClN3O8 — CID 2575768
[2-(carbamoylamino)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate (PubChem CID 2575768) has the molecular formula C17H14ClN3O8 and a molecular weight of 423.77 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 2575768 |
| Molecular Formula | C17H14ClN3O8 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NC(N)=O)ccc1Oc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClN3O8/c1-27-14-6-9(16(23)28-8-15(22)20-17(19)24)2-4-13(14)29-12-5-3-10(18)7-11(12)21(25)26/h2-7H,8H2,1H3,(H3,19,20,22,24) |
| InChIKey | SDTOBVVWUMHXCZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|