C23H20ClN3O7 — CID 55566996
4-(4-chloro-2-nitrophenoxy)-3-methoxy-N-[3-[(2-methoxyacetyl)amino]phenyl]benzamide (PubChem CID 55566996) has the molecular formula C23H20ClN3O7 and a molecular weight of 485.88 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenoxy)-3-methoxy-N-[3-[(2-methoxyacetyl)amino]phenyl]benzamide.
| Compound Name | 4-(4-chloro-2-nitrophenoxy)-3-methoxy-N-[3-[(2-methoxyacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 55566996 |
| Molecular Formula | C23H20ClN3O7 |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-(4-chloro-2-nitrophenoxy)-3-methoxy-N-[3-[(2-methoxyacetyl)amino]phenyl]benzamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)c2ccc(Oc3ccc(Cl)cc3[N+](=O)[O-])c(OC)c2)c1 |
| InChI | InChI=1S/C23H20ClN3O7/c1-32-13-22(28)25-16-4-3-5-17(12-16)26-23(29)14-6-8-20(21(10-14)33-2)34-19-9-7-15(24)11-18(19)27(30)31/h3-12H,13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | TUAYOLVYTKPXHW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|