C20H13ClFN3O7 — CID 26696729
4-(4-chloro-2-nitrophenoxy)-N-(4-fluoro-3-nitrophenyl)-3-methoxybenzamide (PubChem CID 26696729) has the molecular formula C20H13ClFN3O7 and a molecular weight of 461.79 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenoxy)-N-(4-fluoro-3-nitrophenyl)-3-methoxybenzamide.
| Compound Name | 4-(4-chloro-2-nitrophenoxy)-N-(4-fluoro-3-nitrophenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 26696729 |
| Molecular Formula | C20H13ClFN3O7 |
| Molecular Weight | 461.79 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 4-(4-chloro-2-nitrophenoxy)-N-(4-fluoro-3-nitrophenyl)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)ccc1Oc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13ClFN3O7/c1-31-19-8-11(20(26)23-13-4-5-14(22)15(10-13)24(27)28)2-6-18(19)32-17-7-3-12(21)9-16(17)25(29)30/h2-10H,1H3,(H,23,26) |
| InChIKey | IDULWTCDZNPNFT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|