C17H16ClNO7 — CID 9095593
(3,4,5-trimethoxyphenyl)methyl 4-chloro-3-nitrobenzoate (PubChem CID 9095593) has the molecular formula C17H16ClNO7 and a molecular weight of 381.77 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl 4-chloro-3-nitrobenzoate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 9095593 |
| Molecular Formula | C17H16ClNO7 |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl 4-chloro-3-nitrobenzoate |
| SMILES | COc1cc(COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16ClNO7/c1-23-14-6-10(7-15(24-2)16(14)25-3)9-26-17(20)11-4-5-12(18)13(8-11)19(21)22/h4-8H,9H2,1-3H3 |
| InChIKey | CSRNFYXPQUAQKF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|