C21H20O5 — CID 9244590
(3,4,5-trimethoxyphenyl)methyl naphthalene-2-carboxylate (PubChem CID 9244590) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl naphthalene-2-carboxylate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 9244590 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl naphthalene-2-carboxylate |
| SMILES | COc1cc(COC(=O)c2ccc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20O5/c1-23-18-10-14(11-19(24-2)20(18)25-3)13-26-21(22)17-9-8-15-6-4-5-7-16(15)12-17/h4-12H,13H2,1-3H3 |
| InChIKey | CDNIBJGHAUFZCN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |