C20H22O5S2 — CID 9095580
(3,4,5-trimethoxyphenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 9095580) has the molecular formula C20H22O5S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 9095580 |
| Molecular Formula | C20H22O5S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | COc1cc(COC(=O)c2ccc(C3SCCS3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22O5S2/c1-22-16-10-13(11-17(23-2)18(16)24-3)12-25-19(21)14-4-6-15(7-5-14)20-26-8-9-27-20/h4-7,10-11,20H,8-9,12H2,1-3H3 |
| InChIKey | OIWQLDXXAJDBGT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |