C24H24O6 — CID 9095553
(3,4,5-trimethoxyphenyl)methyl 4-(phenoxymethyl)benzoate (PubChem CID 9095553) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl 4-(phenoxymethyl)benzoate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl 4-(phenoxymethyl)benzoate |
|---|---|
| PubChem CID | 9095553 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl 4-(phenoxymethyl)benzoate |
| SMILES | COc1cc(COC(=O)c2ccc(COc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24O6/c1-26-21-13-18(14-22(27-2)23(21)28-3)16-30-24(25)19-11-9-17(10-12-19)15-29-20-7-5-4-6-8-20/h4-14H,15-16H2,1-3H3 |
| InChIKey | OPYRIDTYHCXWCO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |