About (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate
(4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate (PubChem CID 126187152) has the molecular formula C22H19BrO4
and a molecular weight of 427.29 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate |
| PubChem CID | 126187152 |
| Molecular Formula | C22H19BrO4 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate |
| SMILES | COc1ccccc1OCc1ccc(C(=O)OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H19BrO4/c1-25-20-4-2-3-5-21(20)26-14-16-6-10-18(11-7-16)22(24)27-15-17-8-12-19(23)13-9-17/h2-13H,14-15H2,1H3 |
| InChIKey | TYCJCUJEPNXQTB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate?
The IUPAC name of (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate (CID 126187152) is (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate.
What is the SMILES notation for (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate?
The canonical SMILES for (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate is COc1ccccc1OCc1ccc(C(=O)OCc2ccc(Br)cc2)cc1.
What is the InChIKey of (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate?
The InChIKey is TYCJCUJEPNXQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19BrO4/c1-25-20-4-2-3-5-21(20)26-14-16-6-10-18(11-7-16)22(24)27-15-17-8-12-19(23)13-9-17/h2-13H,14-15H2,1H3.
What are the key properties of (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate?
(4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate has a molecular weight of 427.29 g/mol, XLogP of 5.39, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate is sourced from PubChem (CID 126187152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).