C22H18Cl2O4 — CID 126186183
(2,4-dichlorophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate (PubChem CID 126186183) has the molecular formula C22H18Cl2O4 and a molecular weight of 417.29 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate.
| Compound Name | (2,4-dichlorophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 126186183 |
| Molecular Formula | C22H18Cl2O4 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 4-[(2-methoxyphenoxy)methyl]benzoate |
| SMILES | COc1ccccc1OCc1ccc(C(=O)OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2O4/c1-26-20-4-2-3-5-21(20)27-13-15-6-8-16(9-7-15)22(25)28-14-17-10-11-18(23)12-19(17)24/h2-12H,13-14H2,1H3 |
| InChIKey | PVFKVUPNCPTUME-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |