C15H13Cl2NO2S — CID 20991411
3-[(2,4-dichlorophenyl)methoxy]-4-methoxybenzenecarbothioamide (PubChem CID 20991411) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methoxy]-4-methoxybenzenecarbothioamide.
| Compound Name | 3-[(2,4-dichlorophenyl)methoxy]-4-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 20991411 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methoxy]-4-methoxybenzenecarbothioamide |
| SMILES | COc1ccc(C(N)=S)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2NO2S/c1-19-13-5-3-9(15(18)21)6-14(13)20-8-10-2-4-11(16)7-12(10)17/h2-7H,8H2,1H3,(H2,18,21) |
| InChIKey | UGDZZUBEBPQCEV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|