C15H13ClFNOS — CID 29032942
4-[(4-chloro-2-methylphenoxy)methyl]-3-fluorobenzenecarbothioamide (PubChem CID 29032942) has the molecular formula C15H13ClFNOS and a molecular weight of 309.79 g/mol. Its IUPAC name is 4-[(4-chloro-2-methylphenoxy)methyl]-3-fluorobenzenecarbothioamide.
| Compound Name | 4-[(4-chloro-2-methylphenoxy)methyl]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 29032942 |
| Molecular Formula | C15H13ClFNOS |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-[(4-chloro-2-methylphenoxy)methyl]-3-fluorobenzenecarbothioamide |
| SMILES | Cc1cc(Cl)ccc1OCc1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C15H13ClFNOS/c1-9-6-12(16)4-5-14(9)19-8-11-3-2-10(15(18)20)7-13(11)17/h2-7H,8H2,1H3,(H2,18,20) |
| InChIKey | DWAJNNIKODZEEY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|