C25H24O7 — CID 141465485
1-(4-methoxy-3-phenylmethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 141465485) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is 1-(4-methoxy-3-phenylmethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(4-methoxy-3-phenylmethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141465485 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-(4-methoxy-3-phenylmethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(C(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H24O7/c1-28-19-11-10-17(12-20(19)32-15-16-8-6-5-7-9-16)23(26)24(27)18-13-21(29-2)25(31-4)22(14-18)30-3/h5-14H,15H2,1-4H3 |
| InChIKey | SXRPURBYHQTBCN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|