C26H26O7 — CID 11442314
[3-(4-methoxy-3-phenylmethoxyphenyl)oxiran-2-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 11442314) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is [3-(4-methoxy-3-phenylmethoxyphenyl)oxiran-2-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3-(4-methoxy-3-phenylmethoxyphenyl)oxiran-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11442314 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [3-(4-methoxy-3-phenylmethoxyphenyl)oxiran-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C2OC2C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26O7/c1-28-19-11-10-17(12-20(19)32-15-16-8-6-5-7-9-16)24-26(33-24)23(27)18-13-21(29-2)25(31-4)22(14-18)30-3/h5-14,24,26H,15H2,1-4H3 |
| InChIKey | UCTFHQIYDHXCOT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|