C23H20O4 — CID 7036097
(5-methoxy-2-phenylmethoxyphenyl)-[(2R,3R)-3-phenyloxiran-2-yl]methanone (PubChem CID 7036097) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (5-methoxy-2-phenylmethoxyphenyl)-[(2R,3R)-3-phenyloxiran-2-yl]methanone.
| Compound Name | (5-methoxy-2-phenylmethoxyphenyl)-[(2R,3R)-3-phenyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 7036097 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (5-methoxy-2-phenylmethoxyphenyl)-[(2R,3R)-3-phenyloxiran-2-yl]methanone |
| SMILES | COc1ccc(OCc2ccccc2)c(C(=O)[C@@H]2O[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C23H20O4/c1-25-18-12-13-20(26-15-16-8-4-2-5-9-16)19(14-18)21(24)23-22(27-23)17-10-6-3-7-11-17/h2-14,22-23H,15H2,1H3/t22-,23+/m1/s1 |
| InChIKey | YNZXZSPSRYLTNW-PKTZIBPZSA-N |
| XLogP | 4.60 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|