C17H16O4 — CID 11426116
[2-(methoxymethoxy)phenyl]-[(2S,3R)-3-phenyloxiran-2-yl]methanone (PubChem CID 11426116) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is [2-(methoxymethoxy)phenyl]-[(2S,3R)-3-phenyloxiran-2-yl]methanone.
| Compound Name | [2-(methoxymethoxy)phenyl]-[(2S,3R)-3-phenyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 11426116 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [2-(methoxymethoxy)phenyl]-[(2S,3R)-3-phenyloxiran-2-yl]methanone |
| SMILES | COCOc1ccccc1C(=O)[C@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16O4/c1-19-11-20-14-10-6-5-9-13(14)15(18)17-16(21-17)12-7-3-2-4-8-12/h2-10,16-17H,11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | CFCHLWZVBCPJLW-IAGOWNOFSA-N |
| XLogP | 2.99 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|