C20H22O7 — CID 14539344
[(2S,3R)-3-(3,4-dimethoxyphenyl)oxiran-2-yl]-[4-methoxy-2-(methoxymethoxy)phenyl]methanone (PubChem CID 14539344) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(2S,3R)-3-(3,4-dimethoxyphenyl)oxiran-2-yl]-[4-methoxy-2-(methoxymethoxy)phenyl]methanone.
| Compound Name | [(2S,3R)-3-(3,4-dimethoxyphenyl)oxiran-2-yl]-[4-methoxy-2-(methoxymethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 14539344 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(2S,3R)-3-(3,4-dimethoxyphenyl)oxiran-2-yl]-[4-methoxy-2-(methoxymethoxy)phenyl]methanone |
| SMILES | COCOc1cc(OC)ccc1C(=O)[C@H]1O[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H22O7/c1-22-11-26-16-10-13(23-2)6-7-14(16)18(21)20-19(27-20)12-5-8-15(24-3)17(9-12)25-4/h5-10,19-20H,11H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | QBBASCWNSCXJFI-WOJBJXKFSA-N |
| XLogP | 3.02 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|