C18H17BrO5 — CID 124891289
(2-bromo-4,5-dimethoxyphenyl)-[(2S,3R)-3-(3-methoxyphenyl)oxiran-2-yl]methanone (PubChem CID 124891289) has the molecular formula C18H17BrO5 and a molecular weight of 393.23 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-[(2S,3R)-3-(3-methoxyphenyl)oxiran-2-yl]methanone.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-[(2S,3R)-3-(3-methoxyphenyl)oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 124891289 |
| Molecular Formula | C18H17BrO5 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-[(2S,3R)-3-(3-methoxyphenyl)oxiran-2-yl]methanone |
| SMILES | COc1cccc([C@H]2O[C@@H]2C(=O)c2cc(OC)c(OC)cc2Br)c1 |
| InChI | InChI=1S/C18H17BrO5/c1-21-11-6-4-5-10(7-11)17-18(24-17)16(20)12-8-14(22-2)15(23-3)9-13(12)19/h4-9,17-18H,1-3H3/t17-,18-/m1/s1 |
| InChIKey | NRUMQCOWAWWCCF-QZTJIDSGSA-N |
| XLogP | 3.80 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|