C16H17Br2NO4 — CID 53344106
1-(2-bromo-4,5-dimethoxyphenyl)-2-(4-methoxypyridin-1-ium-1-yl)ethanone bromide (PubChem CID 53344106) has the molecular formula C16H17Br2NO4 and a molecular weight of 447.12 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-2-(4-methoxypyridin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-2-(4-methoxypyridin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 53344106 |
| Molecular Formula | C16H17Br2NO4 |
| Molecular Weight | 447.12 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-2-(4-methoxypyridin-1-ium-1-yl)ethanone bromide |
| SMILES | COc1cc[n+](CC(=O)c2cc(OC)c(OC)cc2Br)cc1.[Br-] |
| InChI | InChI=1S/C16H17BrNO4.BrH/c1-20-11-4-6-18(7-5-11)10-14(19)12-8-15(21-2)16(22-3)9-13(12)17;/h4-9H,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GRDZQIGWFPLTOW-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.12 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|