C24H21BrN2O3 — CID 45047405
2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide (PubChem CID 45047405) has the molecular formula C24H21BrN2O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide |
|---|---|
| PubChem CID | 45047405 |
| Molecular Formula | C24H21BrN2O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide |
| SMILES | COc1ccc(-c2cc[n+](CC(=O)c3cccc4ccccc34)cn2)cc1OC.[Br-] |
| InChI | InChI=1S/C24H21N2O3.BrH/c1-28-23-11-10-18(14-24(23)29-2)21-12-13-26(16-25-21)15-22(27)20-9-5-7-17-6-3-4-8-19(17)20;/h3-14,16H,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZKDIJTXEJRIOPK-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|