C19H16Br2N2O2 — CID 44721918
1-(4-bromophenyl)-2-[4-(4-methoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide (PubChem CID 44721918) has the molecular formula C19H16Br2N2O2 and a molecular weight of 464.16 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[4-(4-methoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(4-bromophenyl)-2-[4-(4-methoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 44721918 |
| Molecular Formula | C19H16Br2N2O2 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 1-(4-bromophenyl)-2-[4-(4-methoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide |
| SMILES | COc1ccc(-c2cc[n+](CC(=O)c3ccc(Br)cc3)cn2)cc1.[Br-] |
| InChI | InChI=1S/C19H16BrN2O2.BrH/c1-24-17-8-4-14(5-9-17)18-10-11-22(13-21-18)12-19(23)15-2-6-16(20)7-3-15;/h2-11,13H,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | MBRCSCWHGOHSFC-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|