C25H21N2O2+ — CID 3684672
2-[4-(3-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone (PubChem CID 3684672) has the molecular formula C25H21N2O2+ and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-[4-(3-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 3684672 |
| Molecular Formula | C25H21N2O2+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone |
| SMILES | COc1cccc(-c2cc[n+](CC(=O)c3ccc(-c4ccccc4)cc3)cn2)c1 |
| InChI | InChI=1S/C25H21N2O2/c1-29-23-9-5-8-22(16-23)24-14-15-27(18-26-24)17-25(28)21-12-10-20(11-13-21)19-6-3-2-4-7-19/h2-16,18H,17H2,1H3/q+1 |
| InChIKey | RGSGONMCIQTJSH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|