C25H22BrN2O+ — CID 126958246
2-[4-(4-methylphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone;hydrobromide (PubChem CID 126958246) has the molecular formula C25H22BrN2O+ and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone;hydrobromide.
| Compound Name | 2-[4-(4-methylphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 126958246 |
| Molecular Formula | C25H22BrN2O+ |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[4-(4-methylphenyl)pyrimidin-1-ium-1-yl]-1-(4-phenylphenyl)ethanone;hydrobromide |
| SMILES | Br.Cc1ccc(-c2cc[n+](CC(=O)c3ccc(-c4ccccc4)cc3)cn2)cc1 |
| InChI | InChI=1S/C25H21N2O.BrH/c1-19-7-9-22(10-8-19)24-15-16-27(18-26-24)17-25(28)23-13-11-21(12-14-23)20-5-3-2-4-6-20;/h2-16,18H,17H2,1H3;1H/q+1; |
| InChIKey | CYWWHMCGKNEHIG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|