C20H19BrN2O3 — CID 51056486
1-(3,4-dimethoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide (PubChem CID 51056486) has the molecular formula C20H19BrN2O3 and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 51056486 |
| Molecular Formula | C20H19BrN2O3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2ccc(-c3ccccc3)nc2)cc1OC.[Br-] |
| InChI | InChI=1S/C20H19N2O3.BrH/c1-24-19-9-8-16(12-20(19)25-2)18(23)13-22-11-10-17(21-14-22)15-6-4-3-5-7-15;/h3-12,14H,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZROCFWXLKALUMO-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|