C21H21N2O4+ — CID 4155155
2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 4155155) has the molecular formula C21H21N2O4+ and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 4155155 |
| Molecular Formula | C21H21N2O4+ |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2ccc(-c3ccc(OC)c(OC)c3)nc2)cc1 |
| InChI | InChI=1S/C21H21N2O4/c1-25-17-7-4-15(5-8-17)19(24)13-23-11-10-18(22-14-23)16-6-9-20(26-2)21(12-16)27-3/h4-12,14H,13H2,1-3H3/q+1 |
| InChIKey | HMDFTYINUXJNQE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|