C17H15N2O3+ — CID 4248852
2-[4-(furan-2-yl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 4248852) has the molecular formula C17H15N2O3+ and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[4-(furan-2-yl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 4248852 |
| Molecular Formula | C17H15N2O3+ |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[4-(furan-2-yl)pyrimidin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2ccc(-c3ccco3)nc2)cc1 |
| InChI | InChI=1S/C17H15N2O3/c1-21-14-6-4-13(5-7-14)16(20)11-19-9-8-15(18-12-19)17-3-2-10-22-17/h2-10,12H,11H2,1H3/q+1 |
| InChIKey | CUKAAYYABOFFMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|