C19H17BrN2O2 — CID 44722505
1-(3-methoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide (PubChem CID 44722505) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(3-methoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 44722505 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-(4-phenylpyrimidin-1-ium-1-yl)ethanone bromide |
| SMILES | COc1cccc(C(=O)C[n+]2ccc(-c3ccccc3)nc2)c1.[Br-] |
| InChI | InChI=1S/C19H17N2O2.BrH/c1-23-17-9-5-8-16(12-17)19(22)13-21-11-10-18(20-14-21)15-6-3-2-4-7-15;/h2-12,14H,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZCOBXBCUHSZBPM-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|