C19H16ClN2O2+ — CID 4207979
2-[4-(3-chlorophenyl)pyrimidin-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone (PubChem CID 4207979) has the molecular formula C19H16ClN2O2+ and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)pyrimidin-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone.
| Compound Name | 2-[4-(3-chlorophenyl)pyrimidin-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 4207979 |
| Molecular Formula | C19H16ClN2O2+ |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[4-(3-chlorophenyl)pyrimidin-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)C[n+]2ccc(-c3cccc(Cl)c3)nc2)c1 |
| InChI | InChI=1S/C19H16ClN2O2/c1-24-17-7-3-5-15(11-17)19(23)12-22-9-8-18(21-13-22)14-4-2-6-16(20)10-14/h2-11,13H,12H2,1H3/q+1 |
| InChIKey | OOQODWARRYGWFS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|