C22H23BrN2O5 — CID 44722187
1-(4-methoxyphenyl)-2-[4-(3,4,5-trimethoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide (PubChem CID 44722187) has the molecular formula C22H23BrN2O5 and a molecular weight of 475.34 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[4-(3,4,5-trimethoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(4-methoxyphenyl)-2-[4-(3,4,5-trimethoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 44722187 |
| Molecular Formula | C22H23BrN2O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[4-(3,4,5-trimethoxyphenyl)pyrimidin-1-ium-1-yl]ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2ccc(-c3cc(OC)c(OC)c(OC)c3)nc2)cc1.[Br-] |
| InChI | InChI=1S/C22H23N2O5.BrH/c1-26-17-7-5-15(6-8-17)19(25)13-24-10-9-18(23-14-24)16-11-20(27-2)22(29-4)21(12-16)28-3;/h5-12,14H,13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | UERZMCZUZXLVTH-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|