C20H19BrN2O2 — CID 45046113
2-[4-(2-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide (PubChem CID 45046113) has the molecular formula C20H19BrN2O2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide.
| Compound Name | 2-[4-(2-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide |
|---|---|
| PubChem CID | 45046113 |
| Molecular Formula | C20H19BrN2O2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)pyrimidin-1-ium-1-yl]-1-(4-methylphenyl)ethanone bromide |
| SMILES | COc1ccccc1-c1cc[n+](CC(=O)c2ccc(C)cc2)cn1.[Br-] |
| InChI | InChI=1S/C20H19N2O2.BrH/c1-15-7-9-16(10-8-15)19(23)13-22-12-11-18(21-14-22)17-5-3-4-6-20(17)24-2;/h3-12,14H,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DJKQNIZCGSZKHI-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|