C22H22NO3+ — CID 4651882
2-(4-benzylpyridin-1-ium-1-yl)-1-(2,4-dimethoxyphenyl)ethanone (PubChem CID 4651882) has the molecular formula C22H22NO3+ and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(4-benzylpyridin-1-ium-1-yl)-1-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-(4-benzylpyridin-1-ium-1-yl)-1-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 4651882 |
| Molecular Formula | C22H22NO3+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(4-benzylpyridin-1-ium-1-yl)-1-(2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2ccc(Cc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C22H22NO3/c1-25-19-8-9-20(22(15-19)26-2)21(24)16-23-12-10-18(11-13-23)14-17-6-4-3-5-7-17/h3-13,15H,14,16H2,1-2H3/q+1 |
| InChIKey | KDQQUOUTARUKAG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|