C16H17NO3 — CID 94281074
2-anilino-1-(2,4-dimethoxyphenyl)ethanone (PubChem CID 94281074) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-anilino-1-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-anilino-1-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 94281074 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-anilino-1-(2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CNc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H17NO3/c1-19-13-8-9-14(16(10-13)20-2)15(18)11-17-12-6-4-3-5-7-12/h3-10,17H,11H2,1-2H3 |
| InChIKey | NDFKWDVKSQVXQC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |