C24H27ClN2O3 — CID 69329506
N-(4-anilinobutyl)-2-methoxy-4-phenoxybenzamide;hydrochloride (PubChem CID 69329506) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is N-(4-anilinobutyl)-2-methoxy-4-phenoxybenzamide;hydrochloride.
| Compound Name | N-(4-anilinobutyl)-2-methoxy-4-phenoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 69329506 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(4-anilinobutyl)-2-methoxy-4-phenoxybenzamide;hydrochloride |
| SMILES | COc1cc(Oc2ccccc2)ccc1C(=O)NCCCCNc1ccccc1.Cl |
| InChI | InChI=1S/C24H26N2O3.ClH/c1-28-23-18-21(29-20-12-6-3-7-13-20)14-15-22(23)24(27)26-17-9-8-16-25-19-10-4-2-5-11-19;/h2-7,10-15,18,25H,8-9,16-17H2,1H3,(H,26,27);1H |
| InChIKey | YVGDJQROOAHHIX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|