C13H14BrNO3S — CID 22734952
1-(2,4-dimethoxyphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanone bromide (PubChem CID 22734952) has the molecular formula C13H14BrNO3S and a molecular weight of 344.23 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanone bromide.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanone bromide |
|---|---|
| PubChem CID | 22734952 |
| Molecular Formula | C13H14BrNO3S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2ccsc2)c(OC)c1.[Br-] |
| InChI | InChI=1S/C13H14NO3S.BrH/c1-16-10-3-4-11(13(7-10)17-2)12(15)8-14-5-6-18-9-14;/h3-7,9H,8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SNCHTNFBWCUFDO-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|