C13H16O3 — CID 103454091
(E)-1-(2,4-dimethoxyphenyl)pent-2-en-1-one (PubChem CID 103454091) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)pent-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)pent-2-en-1-one |
|---|---|
| PubChem CID | 103454091 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)pent-2-en-1-one |
| SMILES | CC/C=C/C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H16O3/c1-4-5-6-12(14)11-8-7-10(15-2)9-13(11)16-3/h5-9H,4H2,1-3H3/b6-5+ |
| InChIKey | UYBLPMJWLZRCOZ-AATRIKPKSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|