C12H11O5- — CID 6986520
(E)-4-(2,4-dimethoxyphenyl)-4-oxobut-2-enoate (PubChem CID 6986520) has the molecular formula C12H11O5- and a molecular weight of 235.22 g/mol. Its IUPAC name is (E)-4-(2,4-dimethoxyphenyl)-4-oxobut-2-enoate.
| Compound Name | (E)-4-(2,4-dimethoxyphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6986520 |
| Molecular Formula | C12H11O5- |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (E)-4-(2,4-dimethoxyphenyl)-4-oxobut-2-enoate |
| SMILES | COc1ccc(C(=O)/C=C/C(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C12H12O5/c1-16-8-3-4-9(11(7-8)17-2)10(13)5-6-12(14)15/h3-7H,1-2H3,(H,14,15)/p-1/b6-5+ |
| InChIKey | CGJMPMCLHKGKJV-AATRIKPKSA-M |
| XLogP | 0.19 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|