C36H32N2O10-2 — CID 20840603
(Z)-but-2-enedioate;bis((E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) (PubChem CID 20840603) has the molecular formula C36H32N2O10-2 and a molecular weight of 652.66 g/mol. Its IUPAC name is (Z)-but-2-enedioate;bis((E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one).
| Compound Name | (Z)-but-2-enedioate;bis((E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) |
|---|---|
| PubChem CID | 20840603 |
| Molecular Formula | C36H32N2O10-2 |
| Molecular Weight | 652.66 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | (Z)-but-2-enedioate;bis((E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) |
| SMILES | COc1ccc(C(=O)/C=C/c2ccncc2)c(OC)c1.COc1ccc(C(=O)/C=C/c2ccncc2)c(OC)c1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/2C16H15NO3.C4H4O4/c2*1-19-13-4-5-14(16(11-13)20-2)15(18)6-3-12-7-9-17-10-8-12;5-3(6)1-2-4(7)8/h2*3-11H,1-2H3;1-2H,(H,5,6)(H,7,8)/p-2/b2*6-3+;2-1- |
| InChIKey | XGRJEEWHDQOFAZ-AVLZPPQXSA-L |
| XLogP | 3.03 |
| TPSA | 177.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|