C21H25NO3 — CID 7594013
(E)-3-[4-(diethylamino)phenyl]-1-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 7594013) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (E)-3-[4-(diethylamino)phenyl]-1-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(diethylamino)phenyl]-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7594013 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (E)-3-[4-(diethylamino)phenyl]-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-5-22(6-2)17-10-7-16(8-11-17)9-14-20(23)19-13-12-18(24-3)15-21(19)25-4/h7-15H,5-6H2,1-4H3/b14-9+ |
| InChIKey | QSCKHDAMCPIQHI-NTEUORMPSA-N |
| XLogP | 4.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|